C34H29ClN2O3 — CID 161476387
2-[2-chloro-6-(5-phenyl-1H-imidazol-2-yl)phenyl]-5-[(3S)-3-phenylhexanoyl]benzoic acid (PubChem CID 161476387) has the molecular formula C34H29ClN2O3 and a molecular weight of 549.07 g/mol. Its IUPAC name is 2-[2-chloro-6-(5-phenyl-1H-imidazol-2-yl)phenyl]-5-[(3S)-3-phenylhexanoyl]benzoic acid.
| Compound Name | 2-[2-chloro-6-(5-phenyl-1H-imidazol-2-yl)phenyl]-5-[(3S)-3-phenylhexanoyl]benzoic acid |
|---|---|
| PubChem CID | 161476387 |
| Molecular Formula | C34H29ClN2O3 |
| Molecular Weight | 549.07 g/mol |
| Exact Mass | 548.19 |
| IUPAC Name | 2-[2-chloro-6-(5-phenyl-1H-imidazol-2-yl)phenyl]-5-[(3S)-3-phenylhexanoyl]benzoic acid |
| SMILES | CCC[C@@H](CC(=O)c1ccc(-c2c(Cl)cccc2-c2ncc(-c3ccccc3)[nH]2)c(C(=O)O)c1)c1ccccc1 |
| InChI | InChI=1S/C34H29ClN2O3/c1-2-10-24(22-11-5-3-6-12-22)20-31(38)25-17-18-26(28(19-25)34(39)40)32-27(15-9-16-29(32)35)33-36-21-30(37-33)23-13-7-4-8-14-23/h3-9,11-19,21,24H,2,10,20H2,1H3,(H,36,37)(H,39,40)/t24-/m0/s1 |
| InChIKey | WDTPQQHCVKNNBC-DEOSSOPVSA-N |
| XLogP | 8.92 |
| TPSA | 83.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.07 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |