C33H27F3N2O3 — CID 157332603
2-[2-(1H-benzimidazol-2-yl)-5-(trifluoromethyl)phenyl]-5-[(3S)-3-phenylhexanoyl]benzoic acid (PubChem CID 157332603) has the molecular formula C33H27F3N2O3 and a molecular weight of 556.58 g/mol. Its IUPAC name is 2-[2-(1H-benzimidazol-2-yl)-5-(trifluoromethyl)phenyl]-5-[(3S)-3-phenylhexanoyl]benzoic acid.
| Compound Name | 2-[2-(1H-benzimidazol-2-yl)-5-(trifluoromethyl)phenyl]-5-[(3S)-3-phenylhexanoyl]benzoic acid |
|---|---|
| PubChem CID | 157332603 |
| Molecular Formula | C33H27F3N2O3 |
| Molecular Weight | 556.58 g/mol |
| Exact Mass | 556.20 |
| IUPAC Name | 2-[2-(1H-benzimidazol-2-yl)-5-(trifluoromethyl)phenyl]-5-[(3S)-3-phenylhexanoyl]benzoic acid |
| SMILES | CCC[C@@H](CC(=O)c1ccc(-c2cc(C(F)(F)F)ccc2-c2nc3ccccc3[nH]2)c(C(=O)O)c1)c1ccccc1 |
| InChI | InChI=1S/C33H27F3N2O3/c1-2-8-21(20-9-4-3-5-10-20)18-30(39)22-13-15-24(27(17-22)32(40)41)26-19-23(33(34,35)36)14-16-25(26)31-37-28-11-6-7-12-29(28)38-31/h3-7,9-17,19,21H,2,8,18H2,1H3,(H,37,38)(H,40,41)/t21-/m0/s1 |
| InChIKey | BFLSUEYJDLDGJM-NRFANRHFSA-N |
| XLogP | 8.77 |
| TPSA | 83.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.58 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |