C14H7F6NO — CID 160756573
3,3,4,4,5,5-hexafluoro-2-isoquinolin-1-ylcyclopenten-1-ol (PubChem CID 160756573) has the molecular formula C14H7F6NO and a molecular weight of 319.20 g/mol. Its IUPAC name is 3,3,4,4,5,5-hexafluoro-2-isoquinolin-1-ylcyclopenten-1-ol.
| Compound Name | 3,3,4,4,5,5-hexafluoro-2-isoquinolin-1-ylcyclopenten-1-ol |
|---|---|
| PubChem CID | 160756573 |
| Molecular Formula | C14H7F6NO |
| Molecular Weight | 319.20 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | 3,3,4,4,5,5-hexafluoro-2-isoquinolin-1-ylcyclopenten-1-ol |
| SMILES | OC1=C(c2nccc3ccccc23)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C14H7F6NO/c15-12(16)9(11(22)13(17,18)14(12,19)20)10-8-4-2-1-3-7(8)5-6-21-10/h1-6,22H |
| InChIKey | DUKVTLRNWFSUTR-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.20 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|