C12H10N6 — CID 10130944
6-isoquinolin-1-yl-1,3,5-triazine-2,4-diamine (PubChem CID 10130944) has the molecular formula C12H10N6 and a molecular weight of 238.25 g/mol. Its IUPAC name is 6-isoquinolin-1-yl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-isoquinolin-1-yl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 10130944 |
| Molecular Formula | C12H10N6 |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | 6-isoquinolin-1-yl-1,3,5-triazine-2,4-diamine |
| SMILES | Nc1nc(N)nc(-c2nccc3ccccc23)n1 |
| InChI | InChI=1S/C12H10N6/c13-11-16-10(17-12(14)18-11)9-8-4-2-1-3-7(8)5-6-15-9/h1-6H,(H4,13,14,16,17,18) |
| InChIKey | ZHRAYTRAZFABSD-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 103.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |