About 3H-quinoxalin-2-one;dihydrochloride
3H-quinoxalin-2-one;dihydrochloride (PubChem CID 160758576) has the molecular formula C8H8Cl2N2O
and a molecular weight of 219.07 g/mol. Its IUPAC name is 3H-quinoxalin-2-one;dihydrochloride.
Molecular Properties
| Compound Name | 3H-quinoxalin-2-one;dihydrochloride |
| PubChem CID | 160758576 |
| Molecular Formula | C8H8Cl2N2O |
| Molecular Weight | 219.07 g/mol |
| Exact Mass | 218.00 |
| IUPAC Name | 3H-quinoxalin-2-one;dihydrochloride |
| SMILES | Cl.Cl.O=C1CN=c2ccccc2=N1 |
| InChI | InChI=1S/C8H6N2O.2ClH/c11-8-5-9-6-3-1-2-4-7(6)10-8;;/h1-4H,5H2;2*1H |
| InChIKey | RXTGDKSISDUMDK-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 41.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.07 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3H-quinoxalin-2-one;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3H-quinoxalin-2-one;dihydrochloride?
The IUPAC name of 3H-quinoxalin-2-one;dihydrochloride (CID 160758576) is 3H-quinoxalin-2-one;dihydrochloride.
What is the SMILES notation for 3H-quinoxalin-2-one;dihydrochloride?
The canonical SMILES for 3H-quinoxalin-2-one;dihydrochloride is Cl.Cl.O=C1CN=c2ccccc2=N1.
What is the InChIKey of 3H-quinoxalin-2-one;dihydrochloride?
The InChIKey is RXTGDKSISDUMDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2O.2ClH/c11-8-5-9-6-3-1-2-4-7(6)10-8;;/h1-4H,5H2;2*1H.
What are the key properties of 3H-quinoxalin-2-one;dihydrochloride?
3H-quinoxalin-2-one;dihydrochloride has a molecular weight of 219.07 g/mol, XLogP of 0.31, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3H-quinoxalin-2-one;dihydrochloride is sourced from PubChem (CID 160758576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).