About 1,2-bis(2,2-diethylbutoxy)-4-[4-(4-methylcyclohexyl)phenyl]benzene
1,2-bis(2,2-diethylbutoxy)-4-[4-(4-methylcyclohexyl)phenyl]benzene (PubChem CID 160764728) has the molecular formula C35H54O2
and a molecular weight of 506.82 g/mol. Its IUPAC name is 1,2-bis(2,2-diethylbutoxy)-4-[4-(4-methylcyclohexyl)phenyl]benzene.
Molecular Properties
| Compound Name | 1,2-bis(2,2-diethylbutoxy)-4-[4-(4-methylcyclohexyl)phenyl]benzene |
| PubChem CID | 160764728 |
| Molecular Formula | C35H54O2 |
| Molecular Weight | 506.82 g/mol |
| Exact Mass | 506.41 |
| IUPAC Name | 1,2-bis(2,2-diethylbutoxy)-4-[4-(4-methylcyclohexyl)phenyl]benzene |
| SMILES | CCC(CC)(CC)COc1ccc(-c2ccc(C3CCC(C)CC3)cc2)cc1OCC(CC)(CC)CC |
| InChI | InChI=1S/C35H54O2/c1-8-34(9-2,10-3)25-36-32-23-22-31(24-33(32)37-26-35(11-4,12-5)13-6)30-20-18-29(19-21-30)28-16-14-27(7)15-17-28/h18-24,27-28H,8-17,25-26H2,1-7H3 |
| InChIKey | UKUUTSXCMXEGAJ-UHFFFAOYSA-N |
| XLogP | 10.84 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 506.82 |
| LogP ≤ 5 | 10.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,2-bis(2,2-diethylbutoxy)-4-[4-(4-methylcyclohexyl)phenyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-bis(2,2-diethylbutoxy)-4-[4-(4-methylcyclohexyl)phenyl]benzene?
The IUPAC name of 1,2-bis(2,2-diethylbutoxy)-4-[4-(4-methylcyclohexyl)phenyl]benzene (CID 160764728) is 1,2-bis(2,2-diethylbutoxy)-4-[4-(4-methylcyclohexyl)phenyl]benzene.
What is the SMILES notation for 1,2-bis(2,2-diethylbutoxy)-4-[4-(4-methylcyclohexyl)phenyl]benzene?
The canonical SMILES for 1,2-bis(2,2-diethylbutoxy)-4-[4-(4-methylcyclohexyl)phenyl]benzene is CCC(CC)(CC)COc1ccc(-c2ccc(C3CCC(C)CC3)cc2)cc1OCC(CC)(CC)CC.
What is the InChIKey of 1,2-bis(2,2-diethylbutoxy)-4-[4-(4-methylcyclohexyl)phenyl]benzene?
The InChIKey is UKUUTSXCMXEGAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C35H54O2/c1-8-34(9-2,10-3)25-36-32-23-22-31(24-33(32)37-26-35(11-4,12-5)13-6)30-20-18-29(19-21-30)28-16-14-27(7)15-17-28/h18-24,27-28H,8-17,25-26H2,1-7H3.
What are the key properties of 1,2-bis(2,2-diethylbutoxy)-4-[4-(4-methylcyclohexyl)phenyl]benzene?
1,2-bis(2,2-diethylbutoxy)-4-[4-(4-methylcyclohexyl)phenyl]benzene has a molecular weight of 506.82 g/mol, XLogP of 10.84, 14 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-bis(2,2-diethylbutoxy)-4-[4-(4-methylcyclohexyl)phenyl]benzene is sourced from PubChem (CID 160764728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).