C21H29ClN2O5 — CID 160789546
carbon dioxide;methyl (E)-3,4-dimethyl-2-[[4-(piperazine-1-carbonyl)phenyl]methyl]pent-2-enoate;hydrochloride (PubChem CID 160789546) has the molecular formula C21H29ClN2O5 and a molecular weight of 424.93 g/mol. Its IUPAC name is carbon dioxide;methyl (E)-3,4-dimethyl-2-[[4-(piperazine-1-carbonyl)phenyl]methyl]pent-2-enoate;hydrochloride.
| Compound Name | carbon dioxide;methyl (E)-3,4-dimethyl-2-[[4-(piperazine-1-carbonyl)phenyl]methyl]pent-2-enoate;hydrochloride |
|---|---|
| PubChem CID | 160789546 |
| Molecular Formula | C21H29ClN2O5 |
| Molecular Weight | 424.93 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | carbon dioxide;methyl (E)-3,4-dimethyl-2-[[4-(piperazine-1-carbonyl)phenyl]methyl]pent-2-enoate;hydrochloride |
| SMILES | COC(=O)/C(Cc1ccc(C(=O)N2CCNCC2)cc1)=C(\C)C(C)C.Cl.O=C=O |
| InChI | InChI=1S/C20H28N2O3.CO2.ClH/c1-14(2)15(3)18(20(24)25-4)13-16-5-7-17(8-6-16)19(23)22-11-9-21-10-12-22;2-1-3;/h5-8,14,21H,9-13H2,1-4H3;;1H/b18-15+;; |
| InChIKey | FTGJSEZZGUSZTN-VZRGYXGKSA-N |
| XLogP | 2.26 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.93 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|