C24H31NO7 — CID 66648444
dimethyl 2-[[4-(4-acetyloxypiperidine-1-carbonyl)phenyl]methyl]-3-propan-2-ylbut-2-enedioate (PubChem CID 66648444) has the molecular formula C24H31NO7 and a molecular weight of 445.51 g/mol. Its IUPAC name is dimethyl 2-[[4-(4-acetyloxypiperidine-1-carbonyl)phenyl]methyl]-3-propan-2-ylbut-2-enedioate.
| Compound Name | dimethyl 2-[[4-(4-acetyloxypiperidine-1-carbonyl)phenyl]methyl]-3-propan-2-ylbut-2-enedioate |
|---|---|
| PubChem CID | 66648444 |
| Molecular Formula | C24H31NO7 |
| Molecular Weight | 445.51 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | dimethyl 2-[[4-(4-acetyloxypiperidine-1-carbonyl)phenyl]methyl]-3-propan-2-ylbut-2-enedioate |
| SMILES | COC(=O)C(Cc1ccc(C(=O)N2CCC(OC(C)=O)CC2)cc1)=C(C(=O)OC)C(C)C |
| InChI | InChI=1S/C24H31NO7/c1-15(2)21(24(29)31-5)20(23(28)30-4)14-17-6-8-18(9-7-17)22(27)25-12-10-19(11-13-25)32-16(3)26/h6-9,15,19H,10-14H2,1-5H3 |
| InChIKey | YSEYOXZHVFTTPB-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.51 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|