C20H25NNa2O6 — CID 66648691
CID 66648691 (PubChem CID 66648691) has the molecular formula C20H25NNa2O6 and a molecular weight of 421.40 g/mol.
| Compound Name | CID 66648691 |
|---|---|
| PubChem CID | 66648691 |
| Molecular Formula | C20H25NNa2O6 |
| Molecular Weight | 421.40 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | — |
| SMILES | CC(C)/C(C(=O)O)=C(\Cc1ccc(C(=O)N2CCC(O)CC2)cc1)C(=O)O.[Na].[Na] |
| InChI | InChI=1S/C20H25NO6.2Na/c1-12(2)17(20(26)27)16(19(24)25)11-13-3-5-14(6-4-13)18(23)21-9-7-15(22)8-10-21;;/h3-6,12,15,22H,7-11H2,1-2H3,(H,24,25)(H,26,27);;/b17-16-;; |
| InChIKey | GVPYRLYIWPOVIC-LSSNYKSTSA-N |
| XLogP | 1.19 |
| TPSA | 115.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.40 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|