C21H29ClN2O5 — CID 66648946
dimethyl (Z)-2-[[4-(piperazine-1-carbonyl)phenyl]methyl]-3-propan-2-ylbut-2-enedioate;hydrochloride (PubChem CID 66648946) has the molecular formula C21H29ClN2O5 and a molecular weight of 424.93 g/mol. Its IUPAC name is dimethyl (Z)-2-[[4-(piperazine-1-carbonyl)phenyl]methyl]-3-propan-2-ylbut-2-enedioate;hydrochloride.
| Compound Name | dimethyl (Z)-2-[[4-(piperazine-1-carbonyl)phenyl]methyl]-3-propan-2-ylbut-2-enedioate;hydrochloride |
|---|---|
| PubChem CID | 66648946 |
| Molecular Formula | C21H29ClN2O5 |
| Molecular Weight | 424.93 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | dimethyl (Z)-2-[[4-(piperazine-1-carbonyl)phenyl]methyl]-3-propan-2-ylbut-2-enedioate;hydrochloride |
| SMILES | COC(=O)/C(Cc1ccc(C(=O)N2CCNCC2)cc1)=C(\C(=O)OC)C(C)C.Cl |
| InChI | InChI=1S/C21H28N2O5.ClH/c1-14(2)18(21(26)28-4)17(20(25)27-3)13-15-5-7-16(8-6-15)19(24)23-11-9-22-10-12-23;/h5-8,14,22H,9-13H2,1-4H3;1H/b18-17-; |
| InChIKey | DOIWKXNEUNQOLB-YBFBCAGJSA-N |
| XLogP | 1.99 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.93 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|