C15H26N4O3 — CID 160789647
(2S,5R)-6-methyl-N-[(1-methylpiperidin-3-yl)methoxy]-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carboxamide (PubChem CID 160789647) has the molecular formula C15H26N4O3 and a molecular weight of 310.40 g/mol. Its IUPAC name is (2S,5R)-6-methyl-N-[(1-methylpiperidin-3-yl)methoxy]-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carboxamide.
| Compound Name | (2S,5R)-6-methyl-N-[(1-methylpiperidin-3-yl)methoxy]-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carboxamide |
|---|---|
| PubChem CID | 160789647 |
| Molecular Formula | C15H26N4O3 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | (2S,5R)-6-methyl-N-[(1-methylpiperidin-3-yl)methoxy]-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carboxamide |
| SMILES | CN1CCCC(CONC(=O)[C@@H]2CC[C@@H]3CN2C(=O)N3C)C1 |
| InChI | InChI=1S/C15H26N4O3/c1-17-7-3-4-11(8-17)10-22-16-14(20)13-6-5-12-9-19(13)15(21)18(12)2/h11-13H,3-10H2,1-2H3,(H,16,20)/t11?,12-,13+/m1/s1 |
| InChIKey | SFYQDGUFLRDTFR-HDYSRYHKSA-N |
| XLogP | 0.27 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|