C30H32ClN7O2 — CID 160794460
1-ethylindazole-3-carbonyl chloride;1-ethylindazole-3-carboxamide;1-ethyl-3-methylindazole (PubChem CID 160794460) has the molecular formula C30H32ClN7O2 and a molecular weight of 558.09 g/mol. Its IUPAC name is 1-ethylindazole-3-carbonyl chloride;1-ethylindazole-3-carboxamide;1-ethyl-3-methylindazole.
| Compound Name | 1-ethylindazole-3-carbonyl chloride;1-ethylindazole-3-carboxamide;1-ethyl-3-methylindazole |
|---|---|
| PubChem CID | 160794460 |
| Molecular Formula | C30H32ClN7O2 |
| Molecular Weight | 558.09 g/mol |
| Exact Mass | 557.23 |
| IUPAC Name | 1-ethylindazole-3-carbonyl chloride;1-ethylindazole-3-carboxamide;1-ethyl-3-methylindazole |
| SMILES | CCn1nc(C(=O)Cl)c2ccccc21.CCn1nc(C(N)=O)c2ccccc21.CCn1nc(C)c2ccccc21 |
| InChI | InChI=1S/C10H9ClN2O.C10H11N3O.C10H12N2/c2*1-2-13-8-6-4-3-5-7(8)9(12-13)10(11)14;1-3-12-10-7-5-4-6-9(10)8(2)11-12/h3-6H,2H2,1H3;3-6H,2H2,1H3,(H2,11,14);4-7H,3H2,1-2H3 |
| InChIKey | SCGGUEGYPOOUBJ-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 113.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.09 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|