C26H29F2N3O3 — CID 160798164
4-[[6-(4,4-difluorobut-3-enoxy)-3-methyl-2-oxobenzimidazol-1-yl]methyl]-N-phenylcyclohexane-1-carboxamide (PubChem CID 160798164) has the molecular formula C26H29F2N3O3 and a molecular weight of 469.53 g/mol. Its IUPAC name is 4-[[6-(4,4-difluorobut-3-enoxy)-3-methyl-2-oxobenzimidazol-1-yl]methyl]-N-phenylcyclohexane-1-carboxamide.
| Compound Name | 4-[[6-(4,4-difluorobut-3-enoxy)-3-methyl-2-oxobenzimidazol-1-yl]methyl]-N-phenylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 160798164 |
| Molecular Formula | C26H29F2N3O3 |
| Molecular Weight | 469.53 g/mol |
| Exact Mass | 469.22 |
| IUPAC Name | 4-[[6-(4,4-difluorobut-3-enoxy)-3-methyl-2-oxobenzimidazol-1-yl]methyl]-N-phenylcyclohexane-1-carboxamide |
| SMILES | Cn1c(=O)n(CC2CCC(C(=O)Nc3ccccc3)CC2)c2cc(OCCC=C(F)F)ccc21 |
| InChI | InChI=1S/C26H29F2N3O3/c1-30-22-14-13-21(34-15-5-8-24(27)28)16-23(22)31(26(30)33)17-18-9-11-19(12-10-18)25(32)29-20-6-3-2-4-7-20/h2-4,6-8,13-14,16,18-19H,5,9-12,15,17H2,1H3,(H,29,32) |
| InChIKey | FVVHGOSKGUIERE-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 65.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.53 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|