C25H36N4O5 — CID 66556471
3-[[4-(4-acetylpiperazine-1-carbonyl)cyclohexyl]methyl]-5-(2-methoxyethoxy)-1-methylbenzimidazol-2-one (PubChem CID 66556471) has the molecular formula C25H36N4O5 and a molecular weight of 472.59 g/mol. Its IUPAC name is 3-[[4-(4-acetylpiperazine-1-carbonyl)cyclohexyl]methyl]-5-(2-methoxyethoxy)-1-methylbenzimidazol-2-one.
| Compound Name | 3-[[4-(4-acetylpiperazine-1-carbonyl)cyclohexyl]methyl]-5-(2-methoxyethoxy)-1-methylbenzimidazol-2-one |
|---|---|
| PubChem CID | 66556471 |
| Molecular Formula | C25H36N4O5 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.27 |
| IUPAC Name | 3-[[4-(4-acetylpiperazine-1-carbonyl)cyclohexyl]methyl]-5-(2-methoxyethoxy)-1-methylbenzimidazol-2-one |
| SMILES | COCCOc1ccc2c(c1)n(CC1CCC(C(=O)N3CCN(C(C)=O)CC3)CC1)c(=O)n2C |
| InChI | InChI=1S/C25H36N4O5/c1-18(30)27-10-12-28(13-11-27)24(31)20-6-4-19(5-7-20)17-29-23-16-21(34-15-14-33-3)8-9-22(23)26(2)25(29)32/h8-9,16,19-20H,4-7,10-15,17H2,1-3H3 |
| InChIKey | ZOXGJYVDYZYMQD-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 86.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|