C24H30N4O4 — CID 66555968
4-[[6-(2-methoxyethoxy)-3-methyl-2-oxobenzimidazol-1-yl]methyl]-N-pyridin-4-ylcyclohexane-1-carboxamide (PubChem CID 66555968) has the molecular formula C24H30N4O4 and a molecular weight of 438.53 g/mol. Its IUPAC name is 4-[[6-(2-methoxyethoxy)-3-methyl-2-oxobenzimidazol-1-yl]methyl]-N-pyridin-4-ylcyclohexane-1-carboxamide.
| Compound Name | 4-[[6-(2-methoxyethoxy)-3-methyl-2-oxobenzimidazol-1-yl]methyl]-N-pyridin-4-ylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 66555968 |
| Molecular Formula | C24H30N4O4 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | 4-[[6-(2-methoxyethoxy)-3-methyl-2-oxobenzimidazol-1-yl]methyl]-N-pyridin-4-ylcyclohexane-1-carboxamide |
| SMILES | COCCOc1ccc2c(c1)n(CC1CCC(C(=O)Nc3ccncc3)CC1)c(=O)n2C |
| InChI | InChI=1S/C24H30N4O4/c1-27-21-8-7-20(32-14-13-31-2)15-22(21)28(24(27)30)16-17-3-5-18(6-4-17)23(29)26-19-9-11-25-12-10-19/h7-12,15,17-18H,3-6,13-14,16H2,1-2H3,(H,25,26,29) |
| InChIKey | UQMXYQMRRAPQMQ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|