C34H49IN4O8 — CID 160801338
tert-butyl 4-(3-methoxycarbonylphenyl)piperazine-1-carboxylate;tert-butyl piperazine-1-carboxylate;methyl 3-iodobenzoate (PubChem CID 160801338) has the molecular formula C34H49IN4O8 and a molecular weight of 768.69 g/mol. Its IUPAC name is tert-butyl 4-(3-methoxycarbonylphenyl)piperazine-1-carboxylate;tert-butyl piperazine-1-carboxylate;methyl 3-iodobenzoate.
| Compound Name | tert-butyl 4-(3-methoxycarbonylphenyl)piperazine-1-carboxylate;tert-butyl piperazine-1-carboxylate;methyl 3-iodobenzoate |
|---|---|
| PubChem CID | 160801338 |
| Molecular Formula | C34H49IN4O8 |
| Molecular Weight | 768.69 g/mol |
| Exact Mass | 768.26 |
| IUPAC Name | tert-butyl 4-(3-methoxycarbonylphenyl)piperazine-1-carboxylate;tert-butyl piperazine-1-carboxylate;methyl 3-iodobenzoate |
| SMILES | CC(C)(C)OC(=O)N1CCNCC1.COC(=O)c1cccc(I)c1.COC(=O)c1cccc(N2CCN(C(=O)OC(C)(C)C)CC2)c1 |
| InChI | InChI=1S/C17H24N2O4.C9H18N2O2.C8H7IO2/c1-17(2,3)23-16(21)19-10-8-18(9-11-19)14-7-5-6-13(12-14)15(20)22-4;1-9(2,3)13-8(12)11-6-4-10-5-7-11;1-11-8(10)6-3-2-4-7(9)5-6/h5-7,12H,8-11H2,1-4H3;10H,4-7H2,1-3H3;2-5H,1H3 |
| InChIKey | SDCMPRRYLJKLRY-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 126.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.69 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|