About 1-bromo-4-isocyanobenzene;4-methylphenol
1-bromo-4-isocyanobenzene;4-methylphenol (PubChem CID 160804577) has the molecular formula C14H12BrNO
and a molecular weight of 290.16 g/mol. Its IUPAC name is 1-bromo-4-isocyanobenzene;4-methylphenol.
Molecular Properties
| Compound Name | 1-bromo-4-isocyanobenzene;4-methylphenol |
| PubChem CID | 160804577 |
| Molecular Formula | C14H12BrNO |
| Molecular Weight | 290.16 g/mol |
| Exact Mass | 289.01 |
| IUPAC Name | 1-bromo-4-isocyanobenzene;4-methylphenol |
| SMILES | Cc1ccc(O)cc1.[C-]#[N+]c1ccc(Br)cc1 |
| InChI | InChI=1S/C7H4BrN.C7H8O/c1-9-7-4-2-6(8)3-5-7;1-6-2-4-7(8)5-3-6/h2-5H;2-5,8H,1H3 |
| InChIKey | SDNDLKMHFCTMMC-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 24.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.16 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-4-isocyanobenzene;4-methylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-4-isocyanobenzene;4-methylphenol?
The IUPAC name of 1-bromo-4-isocyanobenzene;4-methylphenol (CID 160804577) is 1-bromo-4-isocyanobenzene;4-methylphenol.
What is the SMILES notation for 1-bromo-4-isocyanobenzene;4-methylphenol?
The canonical SMILES for 1-bromo-4-isocyanobenzene;4-methylphenol is Cc1ccc(O)cc1.[C-]#[N+]c1ccc(Br)cc1.
What is the InChIKey of 1-bromo-4-isocyanobenzene;4-methylphenol?
The InChIKey is SDNDLKMHFCTMMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4BrN.C7H8O/c1-9-7-4-2-6(8)3-5-7;1-6-2-4-7(8)5-3-6/h2-5H;2-5,8H,1H3.
What are the key properties of 1-bromo-4-isocyanobenzene;4-methylphenol?
1-bromo-4-isocyanobenzene;4-methylphenol has a molecular weight of 290.16 g/mol, XLogP of 4.70, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-4-isocyanobenzene;4-methylphenol is sourced from PubChem (CID 160804577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).