C8H14O5S — CID 160806996
4,7-dioxooctane-1-sulfonic acid (PubChem CID 160806996) has the molecular formula C8H14O5S and a molecular weight of 222.26 g/mol. Its IUPAC name is 4,7-dioxooctane-1-sulfonic acid.
| Compound Name | 4,7-dioxooctane-1-sulfonic acid |
|---|---|
| PubChem CID | 160806996 |
| Molecular Formula | C8H14O5S |
| Molecular Weight | 222.26 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | 4,7-dioxooctane-1-sulfonic acid |
| SMILES | CC(=O)CCC(=O)CCCS(=O)(=O)O |
| InChI | InChI=1S/C8H14O5S/c1-7(9)4-5-8(10)3-2-6-14(11,12)13/h2-6H2,1H3,(H,11,12,13) |
| InChIKey | RDQVXZSEKCLCMY-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.26 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|