C29H34IN9O5 — CID 160816264
tert-butyl N-[6-(3-amino-4-methylphenoxy)imidazo[1,2-b]pyridazin-2-yl]carbamate;tert-butyl N-(6-iodoimidazo[1,2-b]pyridazin-2-yl)carbamate (PubChem CID 160816264) has the molecular formula C29H34IN9O5 and a molecular weight of 715.55 g/mol. Its IUPAC name is tert-butyl N-[6-(3-amino-4-methylphenoxy)imidazo[1,2-b]pyridazin-2-yl]carbamate;tert-butyl N-(6-iodoimidazo[1,2-b]pyridazin-2-yl)carbamate.
| Compound Name | tert-butyl N-[6-(3-amino-4-methylphenoxy)imidazo[1,2-b]pyridazin-2-yl]carbamate;tert-butyl N-(6-iodoimidazo[1,2-b]pyridazin-2-yl)carbamate |
|---|---|
| PubChem CID | 160816264 |
| Molecular Formula | C29H34IN9O5 |
| Molecular Weight | 715.55 g/mol |
| Exact Mass | 715.17 |
| IUPAC Name | tert-butyl N-[6-(3-amino-4-methylphenoxy)imidazo[1,2-b]pyridazin-2-yl]carbamate;tert-butyl N-(6-iodoimidazo[1,2-b]pyridazin-2-yl)carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cn2nc(I)ccc2n1.Cc1ccc(Oc2ccc3nc(NC(=O)OC(C)(C)C)cn3n2)cc1N |
| InChI | InChI=1S/C18H21N5O3.C11H13IN4O2/c1-11-5-6-12(9-13(11)19)25-16-8-7-15-20-14(10-23(15)22-16)21-17(24)26-18(2,3)4;1-11(2,3)18-10(17)14-8-6-16-9(13-8)5-4-7(12)15-16/h5-10H,19H2,1-4H3,(H,21,24);4-6H,1-3H3,(H,14,17) |
| InChIKey | SEYHPINWVZMGMD-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 172.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.55 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|