C10H9N2NaO3S3 — CID 160820225
sodium 3-[(5-methylsulfinyl-1,3,4-thiadiazol-2-yl)methyl]benzenesulfinate (PubChem CID 160820225) has the molecular formula C10H9N2NaO3S3 and a molecular weight of 324.38 g/mol. Its IUPAC name is sodium 3-[(5-methylsulfinyl-1,3,4-thiadiazol-2-yl)methyl]benzenesulfinate.
| Compound Name | sodium 3-[(5-methylsulfinyl-1,3,4-thiadiazol-2-yl)methyl]benzenesulfinate |
|---|---|
| PubChem CID | 160820225 |
| Molecular Formula | C10H9N2NaO3S3 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 323.97 |
| IUPAC Name | sodium 3-[(5-methylsulfinyl-1,3,4-thiadiazol-2-yl)methyl]benzenesulfinate |
| SMILES | CS(=O)c1nnc(Cc2cccc(S(=O)[O-])c2)s1.[Na+] |
| InChI | InChI=1S/C10H10N2O3S3.Na/c1-17(13)10-12-11-9(16-10)6-7-3-2-4-8(5-7)18(14)15;/h2-5H,6H2,1H3,(H,14,15);/q;+1/p-1 |
| InChIKey | SFLHQCFOCRRSEA-UHFFFAOYSA-M |
| XLogP | -1.89 |
| TPSA | 82.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|