C35H40BrCl4N — CID 160821911
1-bromo-2,3-dichloro-5-methylbenzene;4-tert-butylaniline;1-[(4-tert-butylphenyl)methyl]-2,3-dichloro-5-methylbenzene (PubChem CID 160821911) has the molecular formula C35H40BrCl4N and a molecular weight of 696.43 g/mol. Its IUPAC name is 1-bromo-2,3-dichloro-5-methylbenzene;4-tert-butylaniline;1-[(4-tert-butylphenyl)methyl]-2,3-dichloro-5-methylbenzene.
| Compound Name | 1-bromo-2,3-dichloro-5-methylbenzene;4-tert-butylaniline;1-[(4-tert-butylphenyl)methyl]-2,3-dichloro-5-methylbenzene |
|---|---|
| PubChem CID | 160821911 |
| Molecular Formula | C35H40BrCl4N |
| Molecular Weight | 696.43 g/mol |
| Exact Mass | 693.11 |
| IUPAC Name | 1-bromo-2,3-dichloro-5-methylbenzene;4-tert-butylaniline;1-[(4-tert-butylphenyl)methyl]-2,3-dichloro-5-methylbenzene |
| SMILES | CC(C)(C)c1ccc(N)cc1.Cc1cc(Cl)c(Cl)c(Br)c1.Cc1cc(Cl)c(Cl)c(Cc2ccc(C(C)(C)C)cc2)c1 |
| InChI | InChI=1S/C18H20Cl2.C10H15N.C7H5BrCl2/c1-12-9-14(17(20)16(19)10-12)11-13-5-7-15(8-6-13)18(2,3)4;1-10(2,3)8-4-6-9(11)7-5-8;1-4-2-5(8)7(10)6(9)3-4/h5-10H,11H2,1-4H3;4-7H,11H2,1-3H3;2-3H,1H3 |
| InChIKey | SFQSICFKAOPMSY-UHFFFAOYSA-N |
| XLogP | 12.82 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.43 |
| LogP ≤ 5 | 12.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|