C57H52BrCl4N — CID 167674794
1-bromo-2,3-dichloro-5-(4-phenylphenyl)benzene;4-tert-butylaniline;1-[(4-tert-butylphenyl)methyl]-2,3-dichloro-5-(4-phenylphenyl)benzene (PubChem CID 167674794) has the molecular formula C57H52BrCl4N and a molecular weight of 972.77 g/mol. Its IUPAC name is 1-bromo-2,3-dichloro-5-(4-phenylphenyl)benzene;4-tert-butylaniline;1-[(4-tert-butylphenyl)methyl]-2,3-dichloro-5-(4-phenylphenyl)benzene.
| Compound Name | 1-bromo-2,3-dichloro-5-(4-phenylphenyl)benzene;4-tert-butylaniline;1-[(4-tert-butylphenyl)methyl]-2,3-dichloro-5-(4-phenylphenyl)benzene |
|---|---|
| PubChem CID | 167674794 |
| Molecular Formula | C57H52BrCl4N |
| Molecular Weight | 972.77 g/mol |
| Exact Mass | 969.20 |
| IUPAC Name | 1-bromo-2,3-dichloro-5-(4-phenylphenyl)benzene;4-tert-butylaniline;1-[(4-tert-butylphenyl)methyl]-2,3-dichloro-5-(4-phenylphenyl)benzene |
| SMILES | CC(C)(C)c1ccc(Cc2cc(-c3ccc(-c4ccccc4)cc3)cc(Cl)c2Cl)cc1.CC(C)(C)c1ccc(N)cc1.Clc1cc(-c2ccc(-c3ccccc3)cc2)cc(Br)c1Cl |
| InChI | InChI=1S/C29H26Cl2.C18H11BrCl2.C10H15N/c1-29(2,3)26-15-9-20(10-16-26)17-25-18-24(19-27(30)28(25)31)23-13-11-22(12-14-23)21-7-5-4-6-8-21;19-16-10-15(11-17(20)18(16)21)14-8-6-13(7-9-14)12-4-2-1-3-5-12;1-10(2,3)8-4-6-9(11)7-5-8/h4-16,18-19H,17H2,1-3H3;1-11H;4-7H,11H2,1-3H3 |
| InChIKey | UQONNUPMUMUXOZ-UHFFFAOYSA-N |
| XLogP | 18.87 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 972.77 |
| LogP ≤ 5 | 18.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|