About 1-(2-hydroxyethyl)imidazolidine-2-thione;imidazolidine-2-thione
1-(2-hydroxyethyl)imidazolidine-2-thione;imidazolidine-2-thione (PubChem CID 160823088) has the molecular formula C8H16N4OS2
and a molecular weight of 248.38 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)imidazolidine-2-thione;imidazolidine-2-thione.
Molecular Properties
| Compound Name | 1-(2-hydroxyethyl)imidazolidine-2-thione;imidazolidine-2-thione |
| PubChem CID | 160823088 |
| Molecular Formula | C8H16N4OS2 |
| Molecular Weight | 248.38 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | 1-(2-hydroxyethyl)imidazolidine-2-thione;imidazolidine-2-thione |
| SMILES | OCCN1CCNC1=S.S=C1NCCN1 |
| InChI | InChI=1S/C5H10N2OS.C3H6N2S/c8-4-3-7-2-1-6-5(7)9;6-3-4-1-2-5-3/h8H,1-4H2,(H,6,9);1-2H2,(H2,4,5,6) |
| InChIKey | SFUMQSGOGXCFQN-UHFFFAOYSA-N |
| XLogP | -1.37 |
| TPSA | 59.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.38 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-hydroxyethyl)imidazolidine-2-thione;imidazolidine-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-hydroxyethyl)imidazolidine-2-thione;imidazolidine-2-thione?
The IUPAC name of 1-(2-hydroxyethyl)imidazolidine-2-thione;imidazolidine-2-thione (CID 160823088) is 1-(2-hydroxyethyl)imidazolidine-2-thione;imidazolidine-2-thione.
What is the SMILES notation for 1-(2-hydroxyethyl)imidazolidine-2-thione;imidazolidine-2-thione?
The canonical SMILES for 1-(2-hydroxyethyl)imidazolidine-2-thione;imidazolidine-2-thione is OCCN1CCNC1=S.S=C1NCCN1.
What is the InChIKey of 1-(2-hydroxyethyl)imidazolidine-2-thione;imidazolidine-2-thione?
The InChIKey is SFUMQSGOGXCFQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N2OS.C3H6N2S/c8-4-3-7-2-1-6-5(7)9;6-3-4-1-2-5-3/h8H,1-4H2,(H,6,9);1-2H2,(H2,4,5,6).
What are the key properties of 1-(2-hydroxyethyl)imidazolidine-2-thione;imidazolidine-2-thione?
1-(2-hydroxyethyl)imidazolidine-2-thione;imidazolidine-2-thione has a molecular weight of 248.38 g/mol, XLogP of -1.37, 2 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-hydroxyethyl)imidazolidine-2-thione;imidazolidine-2-thione is sourced from PubChem (CID 160823088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).