C8H18N4OS2 — CID 5377232
1-(2-hydroxyethyl)-3-methyl-1-[2-(methylcarbamothioylamino)ethyl]thiourea (PubChem CID 5377232) has the molecular formula C8H18N4OS2 and a molecular weight of 250.39 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-3-methyl-1-[2-(methylcarbamothioylamino)ethyl]thiourea.
| Compound Name | 1-(2-hydroxyethyl)-3-methyl-1-[2-(methylcarbamothioylamino)ethyl]thiourea |
|---|---|
| PubChem CID | 5377232 |
| Molecular Formula | C8H18N4OS2 |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | 1-(2-hydroxyethyl)-3-methyl-1-[2-(methylcarbamothioylamino)ethyl]thiourea |
| SMILES | CNC(=S)NCCN(CCO)C(=S)NC |
| InChI | InChI=1S/C8H18N4OS2/c1-9-7(14)11-3-4-12(5-6-13)8(15)10-2/h13H,3-6H2,1-2H3,(H,10,15)(H2,9,11,14) |
| InChIKey | OSWQGTMRTZMYDB-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 59.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|