C7H16N2O3S — CID 127069113
1,1,3-tris(2-hydroxyethyl)thiourea (PubChem CID 127069113) has the molecular formula C7H16N2O3S and a molecular weight of 208.28 g/mol. Its IUPAC name is 1,1,3-tris(2-hydroxyethyl)thiourea.
| Compound Name | 1,1,3-tris(2-hydroxyethyl)thiourea |
|---|---|
| PubChem CID | 127069113 |
| Molecular Formula | C7H16N2O3S |
| Molecular Weight | 208.28 g/mol |
| Exact Mass | 208.09 |
| IUPAC Name | 1,1,3-tris(2-hydroxyethyl)thiourea |
| SMILES | OCCNC(=S)N(CCO)CCO |
| InChI | InChI=1S/C7H16N2O3S/c10-4-1-8-7(13)9(2-5-11)3-6-12/h10-12H,1-6H2,(H,8,13) |
| InChIKey | WPEFCQYJIACLCT-UHFFFAOYSA-N |
| XLogP | -1.86 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.28 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|