C8H17N3O2S2 — CID 134890913
3-[bis(2-hydroxyethyl)carbamothioyl]-1,1-dimethylthiourea (PubChem CID 134890913) has the molecular formula C8H17N3O2S2 and a molecular weight of 251.38 g/mol. Its IUPAC name is 3-[bis(2-hydroxyethyl)carbamothioyl]-1,1-dimethylthiourea.
| Compound Name | 3-[bis(2-hydroxyethyl)carbamothioyl]-1,1-dimethylthiourea |
|---|---|
| PubChem CID | 134890913 |
| Molecular Formula | C8H17N3O2S2 |
| Molecular Weight | 251.38 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | 3-[bis(2-hydroxyethyl)carbamothioyl]-1,1-dimethylthiourea |
| SMILES | CN(C)C(=S)NC(=S)N(CCO)CCO |
| InChI | InChI=1S/C8H17N3O2S2/c1-10(2)7(14)9-8(15)11(3-5-12)4-6-13/h12-13H,3-6H2,1-2H3,(H,9,14,15) |
| InChIKey | QCPGBMKHYRSIRW-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 58.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.38 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|