C9H22N2OS2 — CID 22766663
N-(2-hydroxyethyl)carbamodithioate;triethylazanium (PubChem CID 22766663) has the molecular formula C9H22N2OS2 and a molecular weight of 238.42 g/mol. Its IUPAC name is N-(2-hydroxyethyl)carbamodithioate;triethylazanium.
| Compound Name | N-(2-hydroxyethyl)carbamodithioate;triethylazanium |
|---|---|
| PubChem CID | 22766663 |
| Molecular Formula | C9H22N2OS2 |
| Molecular Weight | 238.42 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | N-(2-hydroxyethyl)carbamodithioate;triethylazanium |
| SMILES | CC[NH+](CC)CC.OCCNC(=S)[S-] |
| InChI | InChI=1S/C6H15N.C3H7NOS2/c1-4-7(5-2)6-3;5-2-1-4-3(6)7/h4-6H2,1-3H3;5H,1-2H2,(H2,4,6,7) |
| InChIKey | VIPJOVZEEKJVMD-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 36.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.42 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|