C13H13BO2 — CID 160831518
2-(4-methylnaphthalen-2-yl)-1,3,2-dioxaborolane (PubChem CID 160831518) has the molecular formula C13H13BO2 and a molecular weight of 212.06 g/mol. Its IUPAC name is 2-(4-methylnaphthalen-2-yl)-1,3,2-dioxaborolane.
| Compound Name | 2-(4-methylnaphthalen-2-yl)-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 160831518 |
| Molecular Formula | C13H13BO2 |
| Molecular Weight | 212.06 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 2-(4-methylnaphthalen-2-yl)-1,3,2-dioxaborolane |
| SMILES | Cc1cc(B2OCCO2)cc2ccccc12 |
| InChI | InChI=1S/C13H13BO2/c1-10-8-12(14-15-6-7-16-14)9-11-4-2-3-5-13(10)11/h2-5,8-9H,6-7H2,1H3 |
| InChIKey | SGVZHNWNGUAJKI-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.06 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|