C25H34BNO5 — CID 160835347
[(4R,8R)-8-benzyl-9-[(4-methoxyphenyl)methylamino]-2-methyl-6,9-dioxononan-4-yl]boronic acid (PubChem CID 160835347) has the molecular formula C25H34BNO5 and a molecular weight of 439.36 g/mol. Its IUPAC name is [(4R,8R)-8-benzyl-9-[(4-methoxyphenyl)methylamino]-2-methyl-6,9-dioxononan-4-yl]boronic acid.
| Compound Name | [(4R,8R)-8-benzyl-9-[(4-methoxyphenyl)methylamino]-2-methyl-6,9-dioxononan-4-yl]boronic acid |
|---|---|
| PubChem CID | 160835347 |
| Molecular Formula | C25H34BNO5 |
| Molecular Weight | 439.36 g/mol |
| Exact Mass | 439.25 |
| IUPAC Name | [(4R,8R)-8-benzyl-9-[(4-methoxyphenyl)methylamino]-2-methyl-6,9-dioxononan-4-yl]boronic acid |
| SMILES | COc1ccc(CNC(=O)C(CC(=O)C[C@@H](CC(C)C)B(O)O)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C25H34BNO5/c1-18(2)13-22(26(30)31)16-23(28)15-21(14-19-7-5-4-6-8-19)25(29)27-17-20-9-11-24(32-3)12-10-20/h4-12,18,21-22,30-31H,13-17H2,1-3H3,(H,27,29)/t21?,22-/m1/s1 |
| InChIKey | POUSXCZKZHACDY-FOIFJWKZSA-N |
| XLogP | 3.41 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.36 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|