C20H23BN2O5 — CID 174143844
[1-[[4-[(4-methoxyphenyl)methylamino]-4-oxobut-2-enoyl]amino]-2-phenylethyl]boronic acid (PubChem CID 174143844) has the molecular formula C20H23BN2O5 and a molecular weight of 382.23 g/mol. Its IUPAC name is [1-[[4-[(4-methoxyphenyl)methylamino]-4-oxobut-2-enoyl]amino]-2-phenylethyl]boronic acid.
| Compound Name | [1-[[4-[(4-methoxyphenyl)methylamino]-4-oxobut-2-enoyl]amino]-2-phenylethyl]boronic acid |
|---|---|
| PubChem CID | 174143844 |
| Molecular Formula | C20H23BN2O5 |
| Molecular Weight | 382.23 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | [1-[[4-[(4-methoxyphenyl)methylamino]-4-oxobut-2-enoyl]amino]-2-phenylethyl]boronic acid |
| SMILES | COc1ccc(CNC(=O)C=CC(=O)NC(Cc2ccccc2)B(O)O)cc1 |
| InChI | InChI=1S/C20H23BN2O5/c1-28-17-9-7-16(8-10-17)14-22-19(24)11-12-20(25)23-18(21(26)27)13-15-5-3-2-4-6-15/h2-12,18,26-27H,13-14H2,1H3,(H,22,24)(H,23,25) |
| InChIKey | SUQRGVQOCXFKLD-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.23 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|