C18H15F2N5O3 — CID 160836212
N-(5,5-difluoro-4,6-dihydro-1H-pyrimidin-2-yl)-6-hydroxy-3-isocyano-2-(3-methoxy-4-pyridinyl)benzamide (PubChem CID 160836212) has the molecular formula C18H15F2N5O3 and a molecular weight of 387.35 g/mol. Its IUPAC name is N-(5,5-difluoro-4,6-dihydro-1H-pyrimidin-2-yl)-6-hydroxy-3-isocyano-2-(3-methoxy-4-pyridinyl)benzamide.
| Compound Name | N-(5,5-difluoro-4,6-dihydro-1H-pyrimidin-2-yl)-6-hydroxy-3-isocyano-2-(3-methoxy-4-pyridinyl)benzamide |
|---|---|
| PubChem CID | 160836212 |
| Molecular Formula | C18H15F2N5O3 |
| Molecular Weight | 387.35 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | N-(5,5-difluoro-4,6-dihydro-1H-pyrimidin-2-yl)-6-hydroxy-3-isocyano-2-(3-methoxy-4-pyridinyl)benzamide |
| SMILES | [C-]#[N+]c1ccc(O)c(C(=O)NC2=NCC(F)(F)CN2)c1-c1ccncc1OC |
| InChI | InChI=1S/C18H15F2N5O3/c1-21-11-3-4-12(26)15(14(11)10-5-6-22-7-13(10)28-2)16(27)25-17-23-8-18(19,20)9-24-17/h3-7,26H,8-9H2,2H3,(H2,23,24,25,27) |
| InChIKey | SHLCRKZZIFKRCO-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 100.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.35 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|