C48H50N6O6 — CID 160837570
3-azidopropane-1,2-diol;[2-[1-azido-3-(2-trityloxyethoxy)propan-2-yl]oxyethoxy-diphenylmethyl]benzene (PubChem CID 160837570) has the molecular formula C48H50N6O6 and a molecular weight of 806.96 g/mol. Its IUPAC name is 3-azidopropane-1,2-diol;[2-[1-azido-3-(2-trityloxyethoxy)propan-2-yl]oxyethoxy-diphenylmethyl]benzene.
| Compound Name | 3-azidopropane-1,2-diol;[2-[1-azido-3-(2-trityloxyethoxy)propan-2-yl]oxyethoxy-diphenylmethyl]benzene |
|---|---|
| PubChem CID | 160837570 |
| Molecular Formula | C48H50N6O6 |
| Molecular Weight | 806.96 g/mol |
| Exact Mass | 806.38 |
| IUPAC Name | 3-azidopropane-1,2-diol;[2-[1-azido-3-(2-trityloxyethoxy)propan-2-yl]oxyethoxy-diphenylmethyl]benzene |
| SMILES | [N-]=[N+]=NCC(COCCOC(c1ccccc1)(c1ccccc1)c1ccccc1)OCCOC(c1ccccc1)(c1ccccc1)c1ccccc1.[N-]=[N+]=NCC(O)CO |
| InChI | InChI=1S/C45H43N3O4.C3H7N3O2/c46-48-47-35-43(50-32-34-52-45(40-25-13-4-14-26-40,41-27-15-5-16-28-41)42-29-17-6-18-30-42)36-49-31-33-51-44(37-19-7-1-8-20-37,38-21-9-2-10-22-38)39-23-11-3-12-24-39;4-6-5-1-3(8)2-7/h1-30,43H,31-36H2;3,7-8H,1-2H2 |
| InChIKey | SHPJYIKQGJFOSK-UHFFFAOYSA-N |
| XLogP | 9.37 |
| TPSA | 174.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.96 |
| LogP ≤ 5 | 9.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|