C23H29FN4O4S — CID 160838023
N,N-dimethylformamide;4-(5-fluoro-2-methoxyphenyl)-2-(1-methylsulfonylpiperidin-4-yl)-1H-pyrrolo[2,3-b]pyridine (PubChem CID 160838023) has the molecular formula C23H29FN4O4S and a molecular weight of 476.57 g/mol. Its IUPAC name is N,N-dimethylformamide;4-(5-fluoro-2-methoxyphenyl)-2-(1-methylsulfonylpiperidin-4-yl)-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | N,N-dimethylformamide;4-(5-fluoro-2-methoxyphenyl)-2-(1-methylsulfonylpiperidin-4-yl)-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 160838023 |
| Molecular Formula | C23H29FN4O4S |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | N,N-dimethylformamide;4-(5-fluoro-2-methoxyphenyl)-2-(1-methylsulfonylpiperidin-4-yl)-1H-pyrrolo[2,3-b]pyridine |
| SMILES | CN(C)C=O.COc1ccc(F)cc1-c1ccnc2[nH]c(C3CCN(S(C)(=O)=O)CC3)cc12 |
| InChI | InChI=1S/C20H22FN3O3S.C3H7NO/c1-27-19-4-3-14(21)11-16(19)15-5-8-22-20-17(15)12-18(23-20)13-6-9-24(10-7-13)28(2,25)26;1-4(2)3-5/h3-5,8,11-13H,6-7,9-10H2,1-2H3,(H,22,23);3H,1-2H3 |
| InChIKey | SHQVBSZRZZWFQA-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 95.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|