C59H61N3O6S2 — CID 160840316
2-(benzylsulfonylamino)-4-(2-phenylethyl)benzoic acid;2-methyl-5-(2-phenylethyl)aniline;N-[2-methyl-5-(2-phenylethyl)phenyl]-1-phenylmethanesulfonamide (PubChem CID 160840316) has the molecular formula C59H61N3O6S2 and a molecular weight of 972.29 g/mol. Its IUPAC name is 2-(benzylsulfonylamino)-4-(2-phenylethyl)benzoic acid;2-methyl-5-(2-phenylethyl)aniline;N-[2-methyl-5-(2-phenylethyl)phenyl]-1-phenylmethanesulfonamide.
| Compound Name | 2-(benzylsulfonylamino)-4-(2-phenylethyl)benzoic acid;2-methyl-5-(2-phenylethyl)aniline;N-[2-methyl-5-(2-phenylethyl)phenyl]-1-phenylmethanesulfonamide |
|---|---|
| PubChem CID | 160840316 |
| Molecular Formula | C59H61N3O6S2 |
| Molecular Weight | 972.29 g/mol |
| Exact Mass | 971.40 |
| IUPAC Name | 2-(benzylsulfonylamino)-4-(2-phenylethyl)benzoic acid;2-methyl-5-(2-phenylethyl)aniline;N-[2-methyl-5-(2-phenylethyl)phenyl]-1-phenylmethanesulfonamide |
| SMILES | Cc1ccc(CCc2ccccc2)cc1N.Cc1ccc(CCc2ccccc2)cc1NS(=O)(=O)Cc1ccccc1.O=C(O)c1ccc(CCc2ccccc2)cc1NS(=O)(=O)Cc1ccccc1 |
| InChI | InChI=1S/C22H21NO4S.C22H23NO2S.C15H17N/c24-22(25)20-14-13-18(12-11-17-7-3-1-4-8-17)15-21(20)23-28(26,27)16-19-9-5-2-6-10-19;1-18-12-13-20(15-14-19-8-4-2-5-9-19)16-22(18)23-26(24,25)17-21-10-6-3-7-11-21;1-12-7-8-14(11-15(12)16)10-9-13-5-3-2-4-6-13/h1-10,13-15,23H,11-12,16H2,(H,24,25);2-13,16,23H,14-15,17H2,1H3;2-8,11H,9-10,16H2,1H3 |
| InChIKey | SHYDUDKIZIBGAE-UHFFFAOYSA-N |
| XLogP | 12.20 |
| TPSA | 155.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 972.29 |
| LogP ≤ 5 | 12.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|