C23H21NO4S — CID 69331386
2-[[(E)-2-phenylethenyl]sulfonylamino]-4-(2-phenylethyl)benzoic acid (PubChem CID 69331386) has the molecular formula C23H21NO4S and a molecular weight of 407.49 g/mol. Its IUPAC name is 2-[[(E)-2-phenylethenyl]sulfonylamino]-4-(2-phenylethyl)benzoic acid.
| Compound Name | 2-[[(E)-2-phenylethenyl]sulfonylamino]-4-(2-phenylethyl)benzoic acid |
|---|---|
| PubChem CID | 69331386 |
| Molecular Formula | C23H21NO4S |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | 2-[[(E)-2-phenylethenyl]sulfonylamino]-4-(2-phenylethyl)benzoic acid |
| SMILES | O=C(O)c1ccc(CCc2ccccc2)cc1NS(=O)(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C23H21NO4S/c25-23(26)21-14-13-20(12-11-18-7-3-1-4-8-18)17-22(21)24-29(27,28)16-15-19-9-5-2-6-10-19/h1-10,13-17,24H,11-12H2,(H,25,26)/b16-15+ |
| InChIKey | HPEGVVPXFASENH-FOCLMDBBSA-N |
| XLogP | 4.58 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |