C16H11NO6S-2 — CID 3385680
5-(2-phenylethenylsulfonylamino)benzene-1,3-dicarboxylate (PubChem CID 3385680) has the molecular formula C16H11NO6S-2 and a molecular weight of 345.33 g/mol. Its IUPAC name is 5-(2-phenylethenylsulfonylamino)benzene-1,3-dicarboxylate.
| Compound Name | 5-(2-phenylethenylsulfonylamino)benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 3385680 |
| Molecular Formula | C16H11NO6S-2 |
| Molecular Weight | 345.33 g/mol |
| Exact Mass | 345.03 |
| IUPAC Name | 5-(2-phenylethenylsulfonylamino)benzene-1,3-dicarboxylate |
| SMILES | O=C([O-])c1cc(NS(=O)(=O)C=Cc2ccccc2)cc(C(=O)[O-])c1 |
| InChI | InChI=1S/C16H13NO6S/c18-15(19)12-8-13(16(20)21)10-14(9-12)17-24(22,23)7-6-11-4-2-1-3-5-11/h1-10,17H,(H,18,19)(H,20,21)/p-2 |
| InChIKey | PIVKKOHQYLJNQI-UHFFFAOYSA-L |
| XLogP | -0.17 |
| TPSA | 126.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.33 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |