About [amino(phenylmethoxy)phosphoryl]oxymethylbenzene;S-(2-nitrophenyl)thiohydroxylamine
[amino(phenylmethoxy)phosphoryl]oxymethylbenzene;S-(2-nitrophenyl)thiohydroxylamine (PubChem CID 160843449) has the molecular formula C20H22N3O5PS
and a molecular weight of 447.45 g/mol. Its IUPAC name is [amino(phenylmethoxy)phosphoryl]oxymethylbenzene;S-(2-nitrophenyl)thiohydroxylamine.
Molecular Properties
| Compound Name | [amino(phenylmethoxy)phosphoryl]oxymethylbenzene;S-(2-nitrophenyl)thiohydroxylamine |
| PubChem CID | 160843449 |
| Molecular Formula | C20H22N3O5PS |
| Molecular Weight | 447.45 g/mol |
| Exact Mass | 447.10 |
| IUPAC Name | [amino(phenylmethoxy)phosphoryl]oxymethylbenzene;S-(2-nitrophenyl)thiohydroxylamine |
| SMILES | NP(=O)(OCc1ccccc1)OCc1ccccc1.NSc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H16NO3P.C6H6N2O2S/c15-19(16,17-11-13-7-3-1-4-8-13)18-12-14-9-5-2-6-10-14;7-11-6-4-2-1-3-5(6)8(9)10/h1-10H,11-12H2,(H2,15,16);1-4H,7H2 |
| InChIKey | SIIHBDHXRSGHDN-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 130.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 447.45 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [amino(phenylmethoxy)phosphoryl]oxymethylbenzene;S-(2-nitrophenyl)thiohydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [amino(phenylmethoxy)phosphoryl]oxymethylbenzene;S-(2-nitrophenyl)thiohydroxylamine?
The IUPAC name of [amino(phenylmethoxy)phosphoryl]oxymethylbenzene;S-(2-nitrophenyl)thiohydroxylamine (CID 160843449) is [amino(phenylmethoxy)phosphoryl]oxymethylbenzene;S-(2-nitrophenyl)thiohydroxylamine.
What is the SMILES notation for [amino(phenylmethoxy)phosphoryl]oxymethylbenzene;S-(2-nitrophenyl)thiohydroxylamine?
The canonical SMILES for [amino(phenylmethoxy)phosphoryl]oxymethylbenzene;S-(2-nitrophenyl)thiohydroxylamine is NP(=O)(OCc1ccccc1)OCc1ccccc1.NSc1ccccc1[N+](=O)[O-].
What is the InChIKey of [amino(phenylmethoxy)phosphoryl]oxymethylbenzene;S-(2-nitrophenyl)thiohydroxylamine?
The InChIKey is SIIHBDHXRSGHDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16NO3P.C6H6N2O2S/c15-19(16,17-11-13-7-3-1-4-8-13)18-12-14-9-5-2-6-10-14;7-11-6-4-2-1-3-5(6)8(9)10/h1-10H,11-12H2,(H2,15,16);1-4H,7H2.
What are the key properties of [amino(phenylmethoxy)phosphoryl]oxymethylbenzene;S-(2-nitrophenyl)thiohydroxylamine?
[amino(phenylmethoxy)phosphoryl]oxymethylbenzene;S-(2-nitrophenyl)thiohydroxylamine has a molecular weight of 447.45 g/mol, XLogP of 5.05, 8 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [amino(phenylmethoxy)phosphoryl]oxymethylbenzene;S-(2-nitrophenyl)thiohydroxylamine is sourced from PubChem (CID 160843449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).