C37H35N4OP — CID 160843518
3-[3-[3-(dimethylamino)propoxy]phenyl]-1H-indazole-5-carbonitrile;triphenylphosphane (PubChem CID 160843518) has the molecular formula C37H35N4OP and a molecular weight of 582.69 g/mol. Its IUPAC name is 3-[3-[3-(dimethylamino)propoxy]phenyl]-1H-indazole-5-carbonitrile;triphenylphosphane.
| Compound Name | 3-[3-[3-(dimethylamino)propoxy]phenyl]-1H-indazole-5-carbonitrile;triphenylphosphane |
|---|---|
| PubChem CID | 160843518 |
| Molecular Formula | C37H35N4OP |
| Molecular Weight | 582.69 g/mol |
| Exact Mass | 582.25 |
| IUPAC Name | 3-[3-[3-(dimethylamino)propoxy]phenyl]-1H-indazole-5-carbonitrile;triphenylphosphane |
| SMILES | CN(C)CCCOc1cccc(-c2n[nH]c3ccc(C#N)cc23)c1.c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H20N4O.C18H15P/c1-23(2)9-4-10-24-16-6-3-5-15(12-16)19-17-11-14(13-20)7-8-18(17)21-22-19;1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18/h3,5-8,11-12H,4,9-10H2,1-2H3,(H,21,22);1-15H |
| InChIKey | SIIMHLGCUDHMRM-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.69 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|