C25H23OZr- — CID 160846154
2-[4-(3,5-dimethylphenyl)-1,5,6,7-tetrahydro-s-indacen-1-id-2-yl]-5-methylfuran;zirconium (PubChem CID 160846154) has the molecular formula C25H23OZr- and a molecular weight of 430.68 g/mol. Its IUPAC name is 2-[4-(3,5-dimethylphenyl)-1,5,6,7-tetrahydro-s-indacen-1-id-2-yl]-5-methylfuran;zirconium.
| Compound Name | 2-[4-(3,5-dimethylphenyl)-1,5,6,7-tetrahydro-s-indacen-1-id-2-yl]-5-methylfuran;zirconium |
|---|---|
| PubChem CID | 160846154 |
| Molecular Formula | C25H23OZr- |
| Molecular Weight | 430.68 g/mol |
| Exact Mass | 429.08 |
| IUPAC Name | 2-[4-(3,5-dimethylphenyl)-1,5,6,7-tetrahydro-s-indacen-1-id-2-yl]-5-methylfuran;zirconium |
| SMILES | Cc1cc(C)cc(-c2c3c(cc4[cH-]c(-c5ccc(C)o5)cc24)CCC3)c1.[Zr] |
| InChI | InChI=1S/C25H23O.Zr/c1-15-9-16(2)11-21(10-15)25-22-6-4-5-18(22)12-19-13-20(14-23(19)25)24-8-7-17(3)26-24;/h7-14H,4-6H2,1-3H3;/q-1; |
| InChIKey | CZFXYPRFWFGGKD-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.68 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|