C52H56Cl2O2SiZr-2 — CID 154439957
dichloro(dimethylsilylidene)zirconium;bis(2-[5,6-dimethyl-4-(3,4,5-trimethylphenyl)-1H-inden-1-id-2-yl]-5-methylfuran) (PubChem CID 154439957) has the molecular formula C52H56Cl2O2SiZr-2 and a molecular weight of 903.23 g/mol. Its IUPAC name is dichloro(dimethylsilylidene)zirconium;bis(2-[5,6-dimethyl-4-(3,4,5-trimethylphenyl)-1H-inden-1-id-2-yl]-5-methylfuran).
| Compound Name | dichloro(dimethylsilylidene)zirconium;bis(2-[5,6-dimethyl-4-(3,4,5-trimethylphenyl)-1H-inden-1-id-2-yl]-5-methylfuran) |
|---|---|
| PubChem CID | 154439957 |
| Molecular Formula | C52H56Cl2O2SiZr-2 |
| Molecular Weight | 903.23 g/mol |
| Exact Mass | 900.25 |
| IUPAC Name | dichloro(dimethylsilylidene)zirconium;bis(2-[5,6-dimethyl-4-(3,4,5-trimethylphenyl)-1H-inden-1-id-2-yl]-5-methylfuran) |
| SMILES | C[Si](C)=[Zr](Cl)Cl.Cc1ccc(-c2cc3c(-c4cc(C)c(C)c(C)c4)c(C)c(C)cc3[cH-]2)o1.Cc1ccc(-c2cc3c(-c4cc(C)c(C)c(C)c4)c(C)c(C)cc3[cH-]2)o1 |
| InChI | InChI=1S/2C25H25O.C2H6Si.2ClH.Zr/c2*1-14-10-22(11-15(2)18(14)5)25-19(6)16(3)9-20-12-21(13-23(20)25)24-8-7-17(4)26-24;1-3-2;;;/h2*7-13H,1-6H3;1-2H3;2*1H;/q2*-1;;;;+2/p-2 |
| InChIKey | OWCRPJDFKDFKCF-UHFFFAOYSA-L |
| XLogP | 16.84 |
| TPSA | 26.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 903.23 |
| LogP ≤ 5 | 16.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|