C50H52Cl2O2SiZr-2 — CID 87358971
dichloro(dimethylsilylidene)zirconium;bis(2-[5-ethyl-4-(3-ethylphenyl)-1H-inden-1-id-2-yl]-5-methylfuran) (PubChem CID 87358971) has the molecular formula C50H52Cl2O2SiZr-2 and a molecular weight of 875.18 g/mol. Its IUPAC name is dichloro(dimethylsilylidene)zirconium;bis(2-[5-ethyl-4-(3-ethylphenyl)-1H-inden-1-id-2-yl]-5-methylfuran).
| Compound Name | dichloro(dimethylsilylidene)zirconium;bis(2-[5-ethyl-4-(3-ethylphenyl)-1H-inden-1-id-2-yl]-5-methylfuran) |
|---|---|
| PubChem CID | 87358971 |
| Molecular Formula | C50H52Cl2O2SiZr-2 |
| Molecular Weight | 875.18 g/mol |
| Exact Mass | 872.22 |
| IUPAC Name | dichloro(dimethylsilylidene)zirconium;bis(2-[5-ethyl-4-(3-ethylphenyl)-1H-inden-1-id-2-yl]-5-methylfuran) |
| SMILES | CCc1cccc(-c2c(CC)ccc3[cH-]c(-c4ccc(C)o4)cc23)c1.CCc1cccc(-c2c(CC)ccc3[cH-]c(-c4ccc(C)o4)cc23)c1.C[Si](C)=[Zr](Cl)Cl |
| InChI | InChI=1S/2C24H23O.C2H6Si.2ClH.Zr/c2*1-4-17-7-6-8-20(13-17)24-18(5-2)10-11-19-14-21(15-22(19)24)23-12-9-16(3)25-23;1-3-2;;;/h2*6-15H,4-5H2,1-3H3;1-2H3;2*1H;/q2*-1;;;;+2/p-2 |
| InChIKey | YATKAULXWKSUQW-UHFFFAOYSA-L |
| XLogP | 16.00 |
| TPSA | 26.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 875.18 |
| LogP ≤ 5 | 16.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|