C54H42Cl2F6O2SiZr-2 — CID 87357844
dichloro(dimethylsilylidene)zirconium;bis(1-[5-ethyl-4-[4-(trifluoromethyl)phenyl]-1H-inden-1-id-2-yl]-2-benzofuran) (PubChem CID 87357844) has the molecular formula C54H42Cl2F6O2SiZr-2 and a molecular weight of 1027.13 g/mol. Its IUPAC name is dichloro(dimethylsilylidene)zirconium;bis(1-[5-ethyl-4-[4-(trifluoromethyl)phenyl]-1H-inden-1-id-2-yl]-2-benzofuran).
| Compound Name | dichloro(dimethylsilylidene)zirconium;bis(1-[5-ethyl-4-[4-(trifluoromethyl)phenyl]-1H-inden-1-id-2-yl]-2-benzofuran) |
|---|---|
| PubChem CID | 87357844 |
| Molecular Formula | C54H42Cl2F6O2SiZr-2 |
| Molecular Weight | 1027.13 g/mol |
| Exact Mass | 1024.13 |
| IUPAC Name | dichloro(dimethylsilylidene)zirconium;bis(1-[5-ethyl-4-[4-(trifluoromethyl)phenyl]-1H-inden-1-id-2-yl]-2-benzofuran) |
| SMILES | CCc1ccc2[cH-]c(-c3occ4ccccc34)cc2c1-c1ccc(C(F)(F)F)cc1.CCc1ccc2[cH-]c(-c3occ4ccccc34)cc2c1-c1ccc(C(F)(F)F)cc1.C[Si](C)=[Zr](Cl)Cl |
| InChI | InChI=1S/2C26H18F3O.C2H6Si.2ClH.Zr/c2*1-2-16-7-8-18-13-20(25-22-6-4-3-5-19(22)15-30-25)14-23(18)24(16)17-9-11-21(12-10-17)26(27,28)29;1-3-2;;;/h2*3-15H,2H2,1H3;1-2H3;2*1H;/q2*-1;;;;+2/p-2 |
| InChIKey | OZHUMXHCRYTUCD-UHFFFAOYSA-L |
| XLogP | 18.60 |
| TPSA | 26.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1027.13 |
| LogP ≤ 5 | 18.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|