C47H46Cl2O2SiZr-2 — CID 154439977
dichloro(dimethylsilylidene)zirconium;2-(5,6-dimethyl-4-phenyl-1H-inden-1-id-2-yl)-5-ethylfuran;2-(5,6-dimethyl-4-phenyl-1H-inden-1-id-2-yl)-5-methylfuran (PubChem CID 154439977) has the molecular formula C47H46Cl2O2SiZr-2 and a molecular weight of 833.10 g/mol. Its IUPAC name is dichloro(dimethylsilylidene)zirconium;2-(5,6-dimethyl-4-phenyl-1H-inden-1-id-2-yl)-5-ethylfuran;2-(5,6-dimethyl-4-phenyl-1H-inden-1-id-2-yl)-5-methylfuran.
| Compound Name | dichloro(dimethylsilylidene)zirconium;2-(5,6-dimethyl-4-phenyl-1H-inden-1-id-2-yl)-5-ethylfuran;2-(5,6-dimethyl-4-phenyl-1H-inden-1-id-2-yl)-5-methylfuran |
|---|---|
| PubChem CID | 154439977 |
| Molecular Formula | C47H46Cl2O2SiZr-2 |
| Molecular Weight | 833.10 g/mol |
| Exact Mass | 830.17 |
| IUPAC Name | dichloro(dimethylsilylidene)zirconium;2-(5,6-dimethyl-4-phenyl-1H-inden-1-id-2-yl)-5-ethylfuran;2-(5,6-dimethyl-4-phenyl-1H-inden-1-id-2-yl)-5-methylfuran |
| SMILES | CCc1ccc(-c2cc3c(-c4ccccc4)c(C)c(C)cc3[cH-]2)o1.C[Si](C)=[Zr](Cl)Cl.Cc1ccc(-c2cc3c(-c4ccccc4)c(C)c(C)cc3[cH-]2)o1 |
| InChI | InChI=1S/C23H21O.C22H19O.C2H6Si.2ClH.Zr/c1-4-20-10-11-22(24-20)19-13-18-12-15(2)16(3)23(21(18)14-19)17-8-6-5-7-9-17;1-14-11-18-12-19(21-10-9-15(2)23-21)13-20(18)22(16(14)3)17-7-5-4-6-8-17;1-3-2;;;/h5-14H,4H2,1-3H3;4-13H,1-3H3;1-2H3;2*1H;/q2*-1;;;;+2/p-2 |
| InChIKey | YAVMCHNFGNVRFL-UHFFFAOYSA-L |
| XLogP | 15.24 |
| TPSA | 26.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 833.10 |
| LogP ≤ 5 | 15.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|