C48H48Cl2O4SiZr-2 — CID 87358410
dichloro(dimethylsilylidene)zirconium;bis(2-[5-ethyl-4-(3-methoxyphenyl)-1H-inden-1-id-2-yl]-5-methylfuran) (PubChem CID 87358410) has the molecular formula C48H48Cl2O4SiZr-2 and a molecular weight of 879.12 g/mol. Its IUPAC name is dichloro(dimethylsilylidene)zirconium;bis(2-[5-ethyl-4-(3-methoxyphenyl)-1H-inden-1-id-2-yl]-5-methylfuran).
| Compound Name | dichloro(dimethylsilylidene)zirconium;bis(2-[5-ethyl-4-(3-methoxyphenyl)-1H-inden-1-id-2-yl]-5-methylfuran) |
|---|---|
| PubChem CID | 87358410 |
| Molecular Formula | C48H48Cl2O4SiZr-2 |
| Molecular Weight | 879.12 g/mol |
| Exact Mass | 876.18 |
| IUPAC Name | dichloro(dimethylsilylidene)zirconium;bis(2-[5-ethyl-4-(3-methoxyphenyl)-1H-inden-1-id-2-yl]-5-methylfuran) |
| SMILES | CCc1ccc2[cH-]c(-c3ccc(C)o3)cc2c1-c1cccc(OC)c1.CCc1ccc2[cH-]c(-c3ccc(C)o3)cc2c1-c1cccc(OC)c1.C[Si](C)=[Zr](Cl)Cl |
| InChI | InChI=1S/2C23H21O2.C2H6Si.2ClH.Zr/c2*1-4-16-9-10-17-12-19(22-11-8-15(2)25-22)14-21(17)23(16)18-6-5-7-20(13-18)24-3;1-3-2;;;/h2*5-14H,4H2,1-3H3;1-2H3;2*1H;/q2*-1;;;;+2/p-2 |
| InChIKey | UTEVLSDIUAODGH-UHFFFAOYSA-L |
| XLogP | 14.89 |
| TPSA | 44.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 879.12 |
| LogP ≤ 5 | 14.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|