C56H52Cl2O2SiZr-2 — CID 87357838
dichloro(dimethylsilylidene)zirconium;bis(5-(5-ethyl-4-naphthalen-2-yl-1H-inden-1-id-2-yl)-2,3-dimethylfuran) (PubChem CID 87357838) has the molecular formula C56H52Cl2O2SiZr-2 and a molecular weight of 947.25 g/mol. Its IUPAC name is dichloro(dimethylsilylidene)zirconium;bis(5-(5-ethyl-4-naphthalen-2-yl-1H-inden-1-id-2-yl)-2,3-dimethylfuran).
| Compound Name | dichloro(dimethylsilylidene)zirconium;bis(5-(5-ethyl-4-naphthalen-2-yl-1H-inden-1-id-2-yl)-2,3-dimethylfuran) |
|---|---|
| PubChem CID | 87357838 |
| Molecular Formula | C56H52Cl2O2SiZr-2 |
| Molecular Weight | 947.25 g/mol |
| Exact Mass | 944.22 |
| IUPAC Name | dichloro(dimethylsilylidene)zirconium;bis(5-(5-ethyl-4-naphthalen-2-yl-1H-inden-1-id-2-yl)-2,3-dimethylfuran) |
| SMILES | CCc1ccc2[cH-]c(-c3cc(C)c(C)o3)cc2c1-c1ccc2ccccc2c1.CCc1ccc2[cH-]c(-c3cc(C)c(C)o3)cc2c1-c1ccc2ccccc2c1.C[Si](C)=[Zr](Cl)Cl |
| InChI | InChI=1S/2C27H23O.C2H6Si.2ClH.Zr/c2*1-4-19-9-11-22-15-24(26-13-17(2)18(3)28-26)16-25(22)27(19)23-12-10-20-7-5-6-8-21(20)14-23;1-3-2;;;/h2*5-16H,4H2,1-3H3;1-2H3;2*1H;/q2*-1;;;;+2/p-2 |
| InChIKey | MTVYSDAZURISRW-UHFFFAOYSA-L |
| XLogP | 17.80 |
| TPSA | 26.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 947.25 |
| LogP ≤ 5 | 17.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|