C62H72Cl2O2Si5Zr-2 — CID 87358228
bis([3-[2-(2-benzofuran-1-yl)-5-methyl-1H-inden-1-id-4-yl]-5-trimethylsilylphenyl]-trimethylsilane);dichloro(dimethylsilylidene)zirconium (PubChem CID 87358228) has the molecular formula C62H72Cl2O2Si5Zr-2 and a molecular weight of 1151.82 g/mol. Its IUPAC name is bis([3-[2-(2-benzofuran-1-yl)-5-methyl-1H-inden-1-id-4-yl]-5-trimethylsilylphenyl]-trimethylsilane);dichloro(dimethylsilylidene)zirconium.
| Compound Name | bis([3-[2-(2-benzofuran-1-yl)-5-methyl-1H-inden-1-id-4-yl]-5-trimethylsilylphenyl]-trimethylsilane);dichloro(dimethylsilylidene)zirconium |
|---|---|
| PubChem CID | 87358228 |
| Molecular Formula | C62H72Cl2O2Si5Zr-2 |
| Molecular Weight | 1151.82 g/mol |
| Exact Mass | 1148.28 |
| IUPAC Name | bis([3-[2-(2-benzofuran-1-yl)-5-methyl-1H-inden-1-id-4-yl]-5-trimethylsilylphenyl]-trimethylsilane);dichloro(dimethylsilylidene)zirconium |
| SMILES | C[Si](C)=[Zr](Cl)Cl.Cc1ccc2[cH-]c(-c3occ4ccccc34)cc2c1-c1cc([Si](C)(C)C)cc([Si](C)(C)C)c1.Cc1ccc2[cH-]c(-c3occ4ccccc34)cc2c1-c1cc([Si](C)(C)C)cc([Si](C)(C)C)c1 |
| InChI | InChI=1S/2C30H33OSi2.C2H6Si.2ClH.Zr/c2*1-20-12-13-21-14-24(30-27-11-9-8-10-22(27)19-31-30)17-28(21)29(20)23-15-25(32(2,3)4)18-26(16-23)33(5,6)7;1-3-2;;;/h2*8-19H,1-7H3;1-2H3;2*1H;/q2*-1;;;;+2/p-2 |
| InChIKey | LERRUJYIKWHVPY-UHFFFAOYSA-L |
| XLogP | 18.24 |
| TPSA | 26.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1151.82 |
| LogP ≤ 5 | 18.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|