C17H14Cl6O6 — CID 160847623
benzene-1,2-dicarbonyl chloride;2,2-diethylpropanedioyl dichloride;oxalyl dichloride (PubChem CID 160847623) has the molecular formula C17H14Cl6O6 and a molecular weight of 527.01 g/mol. Its IUPAC name is benzene-1,2-dicarbonyl chloride;2,2-diethylpropanedioyl dichloride;oxalyl dichloride.
| Compound Name | benzene-1,2-dicarbonyl chloride;2,2-diethylpropanedioyl dichloride;oxalyl dichloride |
|---|---|
| PubChem CID | 160847623 |
| Molecular Formula | C17H14Cl6O6 |
| Molecular Weight | 527.01 g/mol |
| Exact Mass | 523.89 |
| IUPAC Name | benzene-1,2-dicarbonyl chloride;2,2-diethylpropanedioyl dichloride;oxalyl dichloride |
| SMILES | CCC(CC)(C(=O)Cl)C(=O)Cl.O=C(Cl)C(=O)Cl.O=C(Cl)c1ccccc1C(=O)Cl |
| InChI | InChI=1S/C8H4Cl2O2.C7H10Cl2O2.C2Cl2O2/c9-7(11)5-3-1-2-4-6(5)8(10)12;1-3-7(4-2,5(8)10)6(9)11;3-1(5)2(4)6/h1-4H;3-4H2,1-2H3; |
| InChIKey | SIVRDQDZIGBBQH-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 102.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.01 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|