C24H27N3O9 — CID 160858708
1-[3-[(dimethylamino)methyl]-3,4-dihydro-2H-quinolin-1-yl]-3-pyridin-3-ylprop-2-en-1-one;oxalic acid (PubChem CID 160858708) has the molecular formula C24H27N3O9 and a molecular weight of 501.49 g/mol. Its IUPAC name is 1-[3-[(dimethylamino)methyl]-3,4-dihydro-2H-quinolin-1-yl]-3-pyridin-3-ylprop-2-en-1-one;oxalic acid.
| Compound Name | 1-[3-[(dimethylamino)methyl]-3,4-dihydro-2H-quinolin-1-yl]-3-pyridin-3-ylprop-2-en-1-one;oxalic acid |
|---|---|
| PubChem CID | 160858708 |
| Molecular Formula | C24H27N3O9 |
| Molecular Weight | 501.49 g/mol |
| Exact Mass | 501.17 |
| IUPAC Name | 1-[3-[(dimethylamino)methyl]-3,4-dihydro-2H-quinolin-1-yl]-3-pyridin-3-ylprop-2-en-1-one;oxalic acid |
| SMILES | CN(C)CC1Cc2ccccc2N(C(=O)C=Cc2cccnc2)C1.O=C(O)C(=O)O.O=C(O)C(=O)O |
| InChI | InChI=1S/C20H23N3O.2C2H2O4/c1-22(2)14-17-12-18-7-3-4-8-19(18)23(15-17)20(24)10-9-16-6-5-11-21-13-16;2*3-1(4)2(5)6/h3-11,13,17H,12,14-15H2,1-2H3;2*(H,3,4)(H,5,6) |
| InChIKey | SKEWWOKMIHGOFC-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 185.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.49 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|