C24H26N2O7 — CID 70237674
3-(1,3-benzodioxol-5-yl)-1-[3-[(dimethylamino)methyl]-3,4-dihydro-2H-quinolin-1-yl]prop-2-en-1-one;oxalic acid (PubChem CID 70237674) has the molecular formula C24H26N2O7 and a molecular weight of 454.48 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-1-[3-[(dimethylamino)methyl]-3,4-dihydro-2H-quinolin-1-yl]prop-2-en-1-one;oxalic acid.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-1-[3-[(dimethylamino)methyl]-3,4-dihydro-2H-quinolin-1-yl]prop-2-en-1-one;oxalic acid |
|---|---|
| PubChem CID | 70237674 |
| Molecular Formula | C24H26N2O7 |
| Molecular Weight | 454.48 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-1-[3-[(dimethylamino)methyl]-3,4-dihydro-2H-quinolin-1-yl]prop-2-en-1-one;oxalic acid |
| SMILES | CN(C)CC1Cc2ccccc2N(C(=O)C=Cc2ccc3c(c2)OCO3)C1.O=C(O)C(=O)O |
| InChI | InChI=1S/C22H24N2O3.C2H2O4/c1-23(2)13-17-11-18-5-3-4-6-19(18)24(14-17)22(25)10-8-16-7-9-20-21(12-16)27-15-26-20;3-1(4)2(5)6/h3-10,12,17H,11,13-15H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | HSATXBZREUASOO-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 116.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.48 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|