C22H38N4O9 — CID 160865299
(2,5-dioxopyrrolidin-1-yl) 3-[bis[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]amino]-3-oxopropanoate;methane (PubChem CID 160865299) has the molecular formula C22H38N4O9 and a molecular weight of 502.57 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 3-[bis[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]amino]-3-oxopropanoate;methane.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 3-[bis[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]amino]-3-oxopropanoate;methane |
|---|---|
| PubChem CID | 160865299 |
| Molecular Formula | C22H38N4O9 |
| Molecular Weight | 502.57 g/mol |
| Exact Mass | 502.26 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 3-[bis[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]amino]-3-oxopropanoate;methane |
| SMILES | C.CC(C)(C)OC(=O)NCCN(CCNC(=O)OC(C)(C)C)C(=O)CC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C21H34N4O9.CH4/c1-20(2,3)32-18(30)22-9-11-24(12-10-23-19(31)33-21(4,5)6)16(28)13-17(29)34-25-14(26)7-8-15(25)27;/h7-13H2,1-6H3,(H,22,30)(H,23,31);1H4 |
| InChIKey | SLAMFPLYNWGRPZ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 160.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.57 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|